Physics, 13.02.2021 01:00 Chandler1Gaming

Compute the vertical and horizontal components for each of the forces shown. In each case the force is perpendicular to the incline.

Compute the vertical and horizontal components for each of the forces shown. In each case the force

Answers: 1

Show answers

Answers

Answer from: Quest

what do the notation's look like?

Answer from: Quest

object 2 because all the other ones are wrong

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

W= fd
where f is an applied force and d is the distance over which it is applied. when a parachuting skydiver is at constant velocity, he is experiencing "terminal velocity", the point at which his acceleration down is canceled out by air resistance. that means that the resisting force of the air is equal to his weight, but in the opposite direction. with this, we can solve for the work done by the force.
w = fd
w = (92.0)(9.81 m/s^2) (325)
w= 2.93 x 10^5 j
the value for work in this case is positive because it is pushing up on the skydiver, who has a downward force of gravity.
therefore the answer is 2.93 x 10^5 j

Another question on Physics

Physics, 22.06.2019 10:00

Because air contracts as it cools, the air pressure inside a freezer is typically lower than on the outside. why do ice cubes inside a freezer tend to shrink over time? a. the ice dissolves oxygen from the air, forming a denser crystalline matrix.b. the ice reacts chemically with carbon dioxide in the air, forming gaseous carbon compounds.c. the ice melts, and then the liquid freezes as ice crystals on the bottom of the freezer.d. the ice sublimes, and then the water vapor deposits as ice crystals on the sides of the freezer.

Answers: 1

Answer

Physics, 22.06.2019 11:30

Where is the potential energy throughout the loading, cocking, and releasing of the trebuchet?

Answers: 2

Answer

Physics, 22.06.2019 15:30

This is the number of complete movements of a wave per second.

Answers: 1

Answer

Physics, 22.06.2019 22:30

Use the drop-down menus to answer each question. which line represents the movement of a cart with a constant acceleration? a which line represents the movement of a cart with a constant velocity? c which lines represents a cart with no velocity or acceleration? b

Answers: 1

Answer

You know the right answer?

Compute the vertical and horizontal components for each of the forces shown. In each case the force...

Questions