Physics, 28.01.2020 03:31 cbless972

A22.3-g bullet moving at 1 000 m/s is fired through a one-kg block of wood emerging at a speed of 100 m/s. what is the change in the kinetic energy of the bullet-block system as a result of the collision assuming the block is free to move?

Answers: 3

Show answers

Answers

Answer from: atefah88

-10837 J

Explanation:

The law of conservation of momentum states that the initial total momentum is equal to the final total momentum, so:

$p_i = p_f\\m u_b + M u_B = m v_b + M v_B$

where

m = 22.3 g = 0.0223 kg is the mass of the bullet

u_b = 1000 m/s is the initial velocity of the bullet

M = 1 kg is the mass of the block

u_B = 0 is the initial velocity of the block

v_b = 100 m/s is the final velocity of the bullet

v_B is the final velocity of the block

Solving for v_B we find

$v_B = \frac{m u_b-m v_b}{M}=\frac{(0.0223 kg)(1000 m/s)-(0.0223 kg)(100 m/s)}{1 kg}=20.1 m/s$

The total kinetic energy before the collision is:

$K_i = \frac{1}{2}mu_b^2 = \frac{1}{2}(0.0223 kg)(1000 m/s)^2=11,150 J$

And the total kinetic energy after the collision is:

$K_f = \frac{1}{2}mv_b^2 + \frac{1}{2}mv_B^2=\frac{1}{2}(0.0223 kg)(100 m/s)^2 + \frac{1}{2}(1 kg)(20.1 m/s)^2=313.5 J$

So, the change in kinetic energy is

$\Delta K = 313.5 - 11,150 J = -10,837 J$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

seeing the graph would

Another question on Physics

Physics, 22.06.2019 03:00

According to newtons universal law of gravitation, which would change the parh of the ball so it traces out widest curved path possible?

Answers: 1

Answer

Physics, 22.06.2019 07:30

Boxing gloves are padded to lessen the force of a blow. (a) calculate the force exerted by a boxing glove on an opponent’s face, if the glove and face compress 7.50 cm during a blow in which the 7.00-kg arm and glove are brought to rest from an initial speed of 10.0 m/s. (b) calculate the force exerted by an identical blow in the gory old days when no gloves were used and the knuckles and face would compress only 2.00 cm. (c) discuss the magnitude of the force with glove on. does it seem high enough to cause damage even though it is lower than the force with no glove?

Answers: 1

Answer

Physics, 22.06.2019 10:40

Two point charges are on the y axis. a 3.90-µc charge is located at y = 1.25 cm, and a -2.4-µc charge is located at y = −1.80 cm. (a) find the total electric potential at the origin. v (b) find the total electric potential at the point whose coordinates are (1.50 cm, 0). v

Answers: 1

Answer

Physics, 22.06.2019 14:10

Match these items. 1. coulombs __force 2. ohms __emf 3. centimeters __resistance 4. newtons __charge 5. volts __length

Answers: 1

Answer

You know the right answer?

A22.3-g bullet moving at 1 000 m/s is fired through a one-kg block of wood emerging at a speed of 10...

Questions

Physics, 07.12.2021 01:00

At what wind speed does a tropical storm turn into a hurricane?...