When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind of compound is the major organic product

cyclic β keto ester

Explanation:

The  1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 undergoes Dieckmann condensation which is when sodium methoxide ( a base) catalyzed intermolecular condensation of the diester into a cyclic β keto ester. The 1,6 diesters yields five member-ed cyclic β-keto esters while 1,7 diesters yields six member-ed cyclic β-keto ester