Spermine (structure shown) is a compound isolated from sperm. which of the following statements correctly describes an aqueous solution of spermine?
nh2(ch2)3nh(ch2)4nh(ch2)3nh2
question 2 options:
a)
the hydroxide ion concentration in the solution would be greater than that in pure water.
b)
the hydronium ion concentration in the solution would be greater than that in pure water.
c)
the solution would be acidic.
d)
the ph of the solution would be equal to that of pure water.

How do cfcs cause ozone depletion? how do cfcs cause ozone depletion? ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation breaks down cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks two oxygen atoms away from ozone, leaving behind a paired oxygen molecule. ultraviolet radiation creates cfcs, molecules containing chlorine. chlorine then breaks one oxygen atom away from ozone, leaving behind a paired oxygen molecule.