Physics, 31.10.2019 15:31 pineapplefun

The charges on two metallic balls are 5.0 and 7.0 coulombs respectively. they are kept 1.2 meters apart. what is the force of interaction between the two?

Answers: 1

Show answers

Answers

Answer from: Quest

explanation:

Answer from: Quest

explanation:

newton's third law, for every action there is an equal and opposite reaction.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the earths atmosphere is made up of nitrogen and oxygen. solids can turn into gasses through a process called sublimation. sublimation is the transition of a substance directly from the solid to the gas phase, without passing through the intermediate liquid phase.

hope this : d

Another question on Physics

Physics, 22.06.2019 15:50

Ryan is examining the energy of the particles in a bar of gold. what is ryan most likely studying?

Answers: 1

Answer

Physics, 22.06.2019 16:50

Two loudspeakers, 5.5 m apart and facing each other, play identical sounds of the same frequency. you stand halfway between them, where there is a maximum of sound intensity. moving from this point toward one of the speakers, you encounter a minimum of sound intensity when you have moved 0.33 m . assume the speed of sound is 340 m/s.part a) what is the frequency of the sound? part b) if the frequency is then increased while you remain 0.21 m from the center, what is the first frequency for which that location will be a maximum of sound intensity? express your answer to two significant figures and include the appropriate units.

Answers: 2

Answer

Physics, 22.06.2019 17:20

The magnitude of the magnetic field at a certain distance from a long, straight conductor is represented by b. what is the magnitude of the magnetic field at twice the distance from the conductor? a. at twice the distance, the magnitude of the field is 4b.b. at twice the distance, the magnitude of the field is 2b.c. at twice the distance, the magnitude of the field is b/2.d. at twice the distance, the magnitude of the field is b/4.e. at twice the distance, the magnitude of the field remains equal to b.

Answers: 3

Answer

Physics, 22.06.2019 18:00

Cells in the nervous system have a potential difference of 70 mv across the cell membrane separating the interior of the cell from the extracellular fluid. this potential difference is maintained by ion pumps that move charged ions across the membrane. is this an emf? select the correct answer and explanation. 1)no. the ion pumps cannot separate charges; thus, they cannot create a potential difference. 2)yes. the ion pumps cannot separate charges, but they still can create a potential difference. 3)yes. the ion pumps can actively separate charge; thus, they can create a potential difference. 4)no. the ion pumps can separate charges, but they cannot create a potential difference.

Answers: 1

Answer

You know the right answer?

The charges on two metallic balls are 5.0 and 7.0 coulombs respectively. they are kept 1.2 meters ap...

Questions