Apump and its horizontal intake pipe are located 82 m beneath the surface of a large reservoir. the speed of the water in the intake pipe causes the pressure there to decrease, in accord with bernoulli's principle. assuming nonviscous flow, what is the maximum speed with which water can flow through the intake pipe? (assume atmospheric pressure is 1.01 105 pa.)

Ans : Bernoulli's principle states for incompressible non-viscous flow that p/Ď + gâ™h + (1/2)â™v² = constant Evaluate the equation along a stream line from liquid surface of the reservoir (1) to the inlet of the pipe pâ‚/Ď + gâ™hâ‚ + (1/2)â™v₲ = pâ‚‚/Ď + gâ™hâ‚‚ + (1/2)â™v₂² => vâ‚‚ = âš[ 2â™(pâ‚-pâ‚‚)/Ď + 2â™gâ™(hâ‚-hâ‚‚) + v₲ ] lets make some assumptions: - the pressure at the liquid surface is equal to the atmospheric pressure pâ‚ = 1atm = 101325Pa - the velocity of the liquid at the surface (that is the speed at which the liquid level in reservoir decreases) is quite small, so it may be ignored: v₠≠0 So vâ‚‚ = âš[ 2â™(pâ‚-pâ‚‚)/Ď + 2â™gâ™(hâ‚-hâ‚‚) ] The height difference is fixed. So the only variable remaining is the pressure in the pipe. As higher it is as lower the velocity in the pipe is. So you get the maximum velocity for the minimum pressure. Since pressure cannot drop below zero this is pâ‚‚ = 0 Therefore vâ‚‚max = âš[ pâ‚/Ď + gâ™(hâ‚-hâ‚‚) ] = âš[ 2â™101325Pa/1000kg/mÂł + 2â™9.81m/s²â™12m ] = 20.93m/s

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o