Physics, 18.01.2022 09:30 zoet1027

predict (calculate) the potential and kinetic energy at the top of the loop using the law of conservation of energy and the initial position.

predict (calculate) the potential and kinetic energy at the top of the loop using the law of conser

Answers: 3

Show answers

Answers

Answer from: Quest

answer: the correct answer is 1.

explanation: there are various process in which a radioactive nuclei decays:

1) alpha decay: in this process, a heavier nuclei decays into lighter nuclei by releasing alpha particle. the mass number is reduced by 4 units.

$_a^z\textrm{x}\rightarrow _{a-2}^{z-4}+_2^4\alpha$

2) electron capture: in this decay process, a parent nuclei absorbs an electron and gets converted into a neutron. simply, a proton and an electron combines together to form a neutron. mass number does not change in this process.

$_a^z\textrm{x}+_{-1}^0\textrm{e}\rightarrow _{z-1}^a\textrm{y}$

3) gamma ray emission: it is a decay process in which an unstable nuclei gives excess energy by a spontaneous electromagnetic process. this decay releases $\gamma -radiations$ . this process does not change the mass number.

$_a^z\textrm{x}^*\rightarrow _a^z\textrm{x}+_0^0\gamma$

4) positron emission: it is a type of decay process, in which a proton gets converted to neutron and an electron neutrino. this is also known as $\beta ^+$ -decay. in this the mass number remains same.

$_a^z\textrm{x}\rightarrow _{z-1}^a\textrm{y}+_{+1}^0e$

from the above information, we see that only alpha-decay is producing a change in the mass number of the nucleus.

Answer from: Quest

the body's situation won't change the forces are equal opposit and on the same body

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

I’m good with pshycology

Another question on Physics

Physics, 21.06.2019 23:20

The 5-kg cylinder is initially at rest when it is placed in contact with the wall b and the rotor at a. if the rotor always maintains a constant clockwise angular velocity v = 6 rad> s, determine the initial angular acceleration of the cylinder. the coefficient of kinetic friction at the contacting surfaces b and c is mk = 0.2.

Answers: 3

Answer

Physics, 22.06.2019 01:30

For problems 1-3, consider a simple dc brush motor with a permanent magnet stator. with an an consider a simple dc brush motor with a permanent magnet ae supply voltage of 100 v, the no-load speed of the motor is 1000 rpm. this motor can provide a torque of 1.9 n-m at 800 rpm drawing a current of 2 a current are both zero at no load.) 1. with an armature supply voltage of 100 v, the motor is operated at 900 rpm. what is the motor torque? what is the mechanical power delivered by the motor? what is the current draw? what is the electrical power input? what is the energy efficiency of the motor? with an armature supply voltage of 100 v, the motor is operated at 1100 rpm (where it acts as a generator). what torque input is required? what mechanical power is required what current is generated? what is the electrical power generated? what is the energy efficiency of the motor acting as a generator? 2. with an armature supply voltage raised to 120 v, the motor is operated at 1000 rpm. what is the no-load speed? what is the motor torque? what is the mechanical power delivered by the motor? what is the current draw? what is the electrical power input what is the energy efficiency of the motor? 3.

Answers: 3

Answer

Physics, 22.06.2019 05:00

Asmall 21 kilogram canoe is floating downriver at a speed of 1 m/s. what is the canoe's kinetic energy?

Answers: 1

Answer

Physics, 22.06.2019 11:30

4. a 75.0 g piece of ag metal is heated to and dropped into 50.0 g of water at the final temperature of the mixture is what is the specific heat capacity of silver? 5. a 465 g chunk of iron is removed from petrucci, ralph h.. general chemistry (p. 290). pearson education. kindle edition.

Answers: 3

Answer

You know the right answer?

predict (calculate) the potential and kinetic energy at the top of the loop using the law of conserv...

Questions