Physics, 26.10.2021 22:50 seaans20391

Why do atoms
have no electric charge even though most of
rticles have charges?

Answers: 2

Show answers

Answers

Answer from: FailingstudentXD

because the protons and electrons cancel out each others charges

Explanation:

Answer from: smithmorgan773p35885

All atoms have the same number of electrons as protons, so the positive and negative charges "cancel out", making atoms electrically neutral. Unlike protons and neutrons, which are located inside the nucleus at the center of the atom, electrons are found outside the nucleus.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the answer would most likely be c, because if it's a comical piece of information, it may likely not be true, if it's a site that allows anybody to edit the content, it could mean a five year old is typing the info, and if it's a tv show produced by a celeb, it may have a biased opinion.

Another question on Physics

Physics, 21.06.2019 23:10

A248-g piece of copper is dropped into 390 ml of water at 22.6 °c. the final temperature of the water was measured as 39.9 °c. calculate the initial temperature of the piece of copper. assume that all heat transfer occurs between the copper and the water. remember, the density of water is 1.0 g/m

Answers: 1

Answer

Physics, 22.06.2019 00:00

What should the power status of a circuit be when measuring resistance with an ohmmeter?

Answers: 2

Answer

Physics, 22.06.2019 02:10

Which statement correctly describes the relationship between frequency and wavelength?

Answers: 2

Answer

Physics, 22.06.2019 05:50

Sawyer is studying diffraction. he draws a diagram of a plane wave to show how light waves travel. which best describes sawyer’s error? the wave fronts should be perpendicular to the direction in which the waves move. the arrow showing the direction of movement of the waves should be pointing to the left. the arrow showing the direction of movement of the waves should be pointing downward. the wave fronts should be both parallel and perpendicular to the direction in which the waves move.