Physics, 18.09.2021 09:00 Aubreigh29

Pls answer this because i need it

Answers: 1

Show answers

Answers

Answer from: Quest

what type of charge does it have? negative

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

96.77 amp

explanation:

rl = 250/100 = 2.5 ohms.

egl = 250 + (100 × 0.1) + 2 = 262 v.

at 700 r.p.m., eg2 = 262 × 700/1000 = 183.4 v.

if ia is the new current, then eg2 - 2 - (ia × 0.1) = 2.5 ia

which means this will give ia = 96.77 amp.

Answer from: Quest

So since the snail is moving at 3.6 miles per hour you multiply by 5280 to change it into feet per hour. so you get 36*528 ft per hour. since there are 3600 seconds in an hour, you divide 36*528 by 3600. so simplifying we get 528/100 which is 5.28 ft per second

Another question on Physics

Physics, 22.06.2019 01:30

For problems 1-3, consider a simple dc brush motor with a permanent magnet stator. with an an consider a simple dc brush motor with a permanent magnet ae supply voltage of 100 v, the no-load speed of the motor is 1000 rpm. this motor can provide a torque of 1.9 n-m at 800 rpm drawing a current of 2 a current are both zero at no load.) 1. with an armature supply voltage of 100 v, the motor is operated at 900 rpm. what is the motor torque? what is the mechanical power delivered by the motor? what is the current draw? what is the electrical power input? what is the energy efficiency of the motor? with an armature supply voltage of 100 v, the motor is operated at 1100 rpm (where it acts as a generator). what torque input is required? what mechanical power is required what current is generated? what is the electrical power generated? what is the energy efficiency of the motor acting as a generator? 2. with an armature supply voltage raised to 120 v, the motor is operated at 1000 rpm. what is the no-load speed? what is the motor torque? what is the mechanical power delivered by the motor? what is the current draw? what is the electrical power input what is the energy efficiency of the motor? 3.

Answers: 3

Answer

Physics, 22.06.2019 06:40

Alinearly polarized electromagnetic wave has an average intensity of 196 w/m^2. this wave is directed towards two ideal polarizers (in real polarizers, transmission is also effected by reflection and absorption). polarizer a is oriented with its transmission axis at an angle of θ_1=20.8∘ with the incident electric field. polarizer b has its axis at an angle of θ_2=63.0∘ with the incident electric field. what is the average intensity of the wave after it passes through polarizer a? what is the average intensity of the wave after it passes through polarizer b? suppose that the two polarizers a and b are interchanged. what would the average intensity be after passing through both polarizers?

Answers: 2

Answer

Physics, 22.06.2019 21:00

Which of the the following are examples of projectile motion of both projectile motion and two dimensional motion

Answers: 3

Answer

Physics, 22.06.2019 23:50

An alpha particle with kinetic energy 12.5 mev makes a collision with lead nucleus, but it is not "aimed" at the center of the lead nucleus, and has an initial nonzero angular momentum (with respect to the stationary lead nucleus) of magnitude l = p0 b, where p0 is the magnitude of the initial momentum of the alpha particle and b=1.40×10−12 m. (assume that the lead nucleus remains stationary and that it may be treated as a point charge. the atomic number of lead is 82. the alpha particle is a helium nucleus, with atomic number 2.) what is the distance of closest approach?

Answers: 2

Answer

You know the right answer?

Pls answer this because i need it

...

Questions