Physics, 31.08.2021 01:10 monserratmendezca20

An astronaut finishes some work on the outside of his satellite, which is in circular orbit around the Earth. He leaves his wrench outside the satellite. If there is no air resistance, the wrench will:. a. spiral down to the Earth
b. continue in orbit with the satellite
c. continue in orbit at reduced speed
d. fall directly down to the Earth
e. fly off tangentially into space

Answers: 1

Show answers

Answers

Answer from: Quest

the grams of oxygen gas that can be produced is 20.6 grams of o₂

calculation

2liclo₃ → 2 licl + 3 o₂

step 1: find the moles of liclo₃

moles = mass÷ molar mass

from periodic table the molar mass of liclo₃ =6.9 +35.5 +(16 x3) =90.4 g/mol

moles=38.7 g÷90.4 g/mol=0.4281 moles

step 2: use the mole ratio to calculate the moles of o2

from equation above, liclo₃: o₂ is 2: 3

therefore the moles of o₂=0.4281 moles x3/2 =0.6422 moles

step 3: find mass of o₂

mass= moles x molar mass

from periodic table the molar mass of o₂ = 16 x2= 32 g/mol

mass=0.6422 moles x 32 g/mol = 20.6 grams of o₂

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

The answer is orbit around nucleus

Answer from: Quest

How many calories in food

Another question on Physics

Physics, 22.06.2019 01:10

If vx = 7.00 units and vy = -7.60 units, determine the magnitude of v⃗ . determine the direction of v⃗ .

Answers: 2

Answer

Physics, 22.06.2019 04:10

Time remainin52: 42the chart shows data for a moving object.which conclusion is best supported by the information inthe chart? time (s)velocity (m/s

Answers: 3

Answer

Physics, 22.06.2019 05:50

High schoolphysics 5+3 pts a neon light consists of a glass tube with metal wires at each end. when connected to a high-voltage source, the gas glows. if a fly lands on the glass tube, what will most likely happen? a) the fly will not feel a shock because the glass conducts any free electrons back into the gas. b) electrons will flow directly from the metal wires along the glass and shock the fly. c) the fly will not feel a shock because the glass insulates it from the electrons in the gas and the metal. d) electrons that are moving through the gas will be conducted through the glass and shock the fly.

Answers: 3

Answer

Physics, 22.06.2019 06:00

A1,700kg car is being used to give a 1,400kg car a push start by exerting a force of 140n the impulse on the smaller car during the 30.0s of contact is +670kg*m/s. what is the impulse of the smaller car on the larger car? -814 kg*m/s 0kg *m/s -670kg*m/s -550kg*m/s

Answers: 1

Answer

You know the right answer?

An astronaut finishes some work on the outside of his satellite, which is in circular orbit around t...

Questions