Akia is balancing the equation na + h2o naoh + h2. he tries to find the coefficients that will balance the equation.

how could he find the correct coefficients?

a: by counting up each individual atom and make sure the atom numbers are the same in the reactants and the products
b: by counting up the total atoms and make sure the number of atoms in the reactants is the same as the number of atoms in the products
c: by counting up the total mass of each compound and make sure the reactants are more than the products
d: by counting up the mass of each atom and make sure the reactants are more than the products

Answer;

A: by counting up each individual atom and make sure the atom numbers are the same in the reactants and the products

Explanation;According to the law of conservation of mass, the mass of reactants should always be the same as the mass of the products in a chemical equation. Therefore, the number of atoms of each element in a chemical equation should always be the same on both sides of the equation, that is the side of reactants and side of products.Thus, any chemical equation requires balancing to ensure that the number of atoms of each element is equal in both sides of the equation. Balancing is a try and error process that ensures that the law of conservation of mass holds.In this case, the balanced equation would be;                                               2Na +2H₂O → 2NaOH +H₂

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Because the dept in the ocean