Physics, 04.02.2020 01:56 Keekee9847

What is a wave frequency? a. the number of waves that pass a fixed point in a fixed period of time b. the speed that a wave is passed from particle to particle through a medium c. the loudness of a wave as it travels though the air d. the height of a wave between peak and trough

Answers: 3

Show answers

Answers

Answer from: codyclay

Frequency - number of waves (vibrations, revolutions, of cycles) that pass a given point per unit time.

the correct answer should be A

hope this helps :)

Answer from: barstr9146

A. the number of waves that pass a fixed point in a fixed period of time

Explanation:

A wave is a disturbance that travels in a medium. Frequency of a wave can be defined as the number of waves passing through a fixed time per second. It is measured in Hertz. Wavelength is the distance between two crests or troughs. Amplitude is half height of a wave between peak and trough.

Thus, option A is correct.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the part of the wave he is travelling on is the crest

Another question on Physics

Physics, 22.06.2019 03:10

Athin plate moves between two parallel, horizontal, stationary flat surfaces at a constant velocity of v = 7.5 m/s. the two stationary surfaces are spaced 4 cm apart, and the medium between them is filled with oil whose viscosity is 0.9 n·s/m2. the part of the plate immersed in oil at any given time is 2 m long and 0.5 m wide. if the plate moves through the mid-plane between the surfaces, determine the force required to maintain this motion. what would your response be if the plate was 1 cm from the bottom surface (h2) and 3 cm from the top surface (h1)? if the plate moves through the mid-plane between the surfaces, the force required to maintain the motion will be n. if the plate was 1 cm from the bottom surface (h2) and 3 cm from the top (h1) surface, the force required to maintain the motion would be n.

Answers: 2

Answer

Physics, 22.06.2019 04:10

Time remainin52: 42the chart shows data for a moving object.which conclusion is best supported by the information inthe chart? time (s)velocity (m/s

Answers: 3

Answer

Physics, 22.06.2019 07:20

Diamond will scratch quartz. true or false

Answers: 2

Answer

Physics, 22.06.2019 13:00

Nacidified solution was electrolyzed using copper electrodes. a constant current of 1.18 a caused the anode to lose 0.584 g after 1.52 ✕ 103 s. given that the charge of an electron is 1.6022 ✕ 10−19 c, calculate avogadro's number. assume that copper is oxidized to cu2+ ions.

Answers: 1

Answer

You know the right answer?

What is a wave frequency? a. the number of waves that pass a fixed point in a fixed period of time...

Questions