Physics, 18.03.2021 17:00 maevemboucher78

What dose nuclear reactions produce?

Answers: 3

Show answers

Answers

Answer from: brainy51

A typical nuclear reaction involves two reacting particles—a heavy target nucleus and a light bombarding particle—and produces two new particles—a heavier product nucleus and a lighter ejected particle.

Explanation:

*does

Answer from: ayoismeisalex

a new chromebook for you and you will get to know the other one that

Answer from: Quest

the working equation for the angular size is the product of the physical size and 360 degrees divided by the product of two pi and distance from earth. the minimum size would be 0.559 degrees while the maximum size would be 0.49 degrees.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 20:30

F500 j of energy were added to 1 kg of each of these samples, which would experience the least temperature increase?

Answers: 2

Answer

Physics, 22.06.2019 11:00

I'm thinking it's 2 you are asked to explain the earth's magnetic field. which is the best reply? 1. the earth's magnetic south is similar to the north pole of a magnet. 2. the earth's core has a strong magnetic charge similar to the south pole of a magnet. 3. the earth's geomagnetic south is similar to the south pole of a magnet. 4. the earth's magnetic charge is not centered at either pole; it varies based on location.

Answers: 1

Answer

Physics, 22.06.2019 15:10

Where do magnetic lines of force enter earth?

Answers: 3

Answer

Physics, 23.06.2019 03:30

Which statement is true? a) the work done to lift an object 6 meters is greater than the gravitational potential energy it gains. b) the work required to push an object is less than the work required to pull an object the same distance. c) the work required to raise an object to a height is equal to the gravitational potential energy the object gains. d) the work done against gravity to lift an object straight up is greater than the work required to roll it up a ramp.