Physics, 25.02.2021 18:30 haley4023

An object moving with a speed of 35 m/a and has a kinetic energy of 1500j, what is the mass of the object

Answers: 2

Show answers

Answers

Answer from: svarner2001

Explanation:

Speed or velocity (V) = 35 m/s

Kinetic energy (K. E) = 1500 Joule

mass (m) = ?

We know

K.E = 1/2 * m * v²

1500 = 1/2 * m * 35²

1500 * 2 = 1225m

m = 3000 / 1225

m = 2.45 kg

The mass of the object is 2.45 kg

Hope it will help :)

Answer from: Quest

cell differentiation is how generic embryonic cells become specialized cells. this occurs through a process called gene expression. gene expression is the specific combination of genes that are turned on or off (expressed or repressed), and this is what dictates how a cell functions.

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 05:30

Suppose you have three polarizing filters, with the second at an angle of 42∘ to the first and the third at an angle of 90∘ to the first. by what perfect will the original intensity of unpolarized light be reduced to after passing through all three filters?

Answers: 2

Answer

Physics, 22.06.2019 06:30

Apebble is thrown into a calm lake, ripples are formed from the center and move outward. the water particles in the lake travel in a circular pattern that moves up and down on the surface of a lake, and the energy travels a) diagonally. b) downward. c) horizontally. d) upward.

Answers: 2

Answer

Physics, 22.06.2019 14:40

Asolid cylinder and a cylindrical shell have the same mass, same radius, and turn on frictionless, horizontal axles. the cylindrical shell has light-weight spokes connecting the shell to the axle. a rope is wrapped around each cylinder and tied to blocks of equal masses that are held the same height above the ground. both blocks are released simultaneously. the ropes do not slip. which block hits the ground first? or is it a tie?

Answers: 3

Answer

Physics, 22.06.2019 16:00

In which of the following is positive work done by a person on a suitcase

Answers: 1

Answer

You know the right answer?

An object moving with a speed of 35 m/a and has a kinetic energy of 1500j, what is the mass of the o...

Questions