Physics, 08.11.2020 15:40 Seaport

Compute the latent heat of 10 kg substance if the amount of heat for a phase change is 300 kJ.

Answers: 3

Show answers

Answers

Answer from: rosezgomez97

simply because mass = velocity

and from this 7(8902314_ it is simple

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the minimum constant speed at which she can catch the train is 2.7 m/s

given:

acceleration = 0.6 $\frac{m}{s^{2} }$

time = 4.5 s

to find:

velocity = ?

formula used:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

solution:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

v = 0 + (0.6 × 4.5)

v = 2.7 m/s

the minimum constant speed at which she can catch the train is 2.7 m/s

Another question on Physics

Physics, 22.06.2019 07:30

Examine the nuclear reacti why is this classified as a nuclear reaction rather than a chemical reaction? it is not balanced. a new compound is formed. a change has occurred in a nucleus. a new element has been formed.

Answers: 2

Answer

Physics, 22.06.2019 08:20

A3030 cmcm wrench is used to loosen a bolt with a force applied 0.30.3 mm from the bolt. it takes 6060 nn to loosen the bolt when the force is applied perpendicular to the wrench. how much force would it take if the force was applied at a 3030 degree angle from perpendicular? a 3030 cmcm wrench is used to loosen a bolt with a force applied 0.30.3 mm from the bolt. it takes 6060 nn to loosen the bolt when the force is applied perpendicular to the wrench. how much force would it take if the force was applied at a 3030 degree angle from perpendicular?

Answers: 3

Answer

Physics, 22.06.2019 08:30

An automobile steering wheel is shown. what is the ideal mechanical advantage? if the ama is 8, what is the efficiency of the steering wheel?

Answers: 1

Answer

Physics, 22.06.2019 11:00

1. jay fills a wagon with sand (about 20 kg) and pulls it with a rope 30 m along the beach. he holds the rope 25° above the horizontal. the rope exerts a 20-n tension force on the wagon. how much work does the rope do on the wagon?

Answers: 1

Answer

You know the right answer?

Compute the latent heat of 10 kg substance if the amount of heat for a phase change is 300 kJ....

Questions