DIRECTIONS: Use the same paper when you submit for both assignments below Assignment 1:
A. Define in your own words the meaning of Newton's 2nd Law of Motion. Explain the
meaning of equation, F = MX A and include how each variable - F, M & A is measured or
labeled. For example, distance is measured or labeled in meters or m.
Assignment 2:
A. Write a QCER (Question - Claim - Evidence (2) - Reasoning (3-5 sentence explanation).
For the Question, you may simply ask, "What wđuld happen if I throw a baseball really hard at
the Batter or Hitter?" or "What would happen if I don't swing hard at a golf ball on the tee?" or
"What does it mean if I can dunk a basketball even though I'm only 6 feet tall?"
Remember the Claim is the answer of the question you've stated. For the Evidence, use your
favorite Sport/Team. Your Reasoning needs to explain in details how the 2nd Law of Motion and
F=MXA are applied in your chosen sport/team.
B. Google a picture of your chosen sport/team and submit it with this assignment.
REMEMBER--Put both assignments on the same paper when you submit them!

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o