Physics, 04.11.2020 08:50 pearfam98

Question 2 2. what cause the rusting iron nails or iron made materials in a wet Cloth?
A. presence of heat
B. absence of heat
C. presence of oxygen
D. absence of oxygen

Answers: 3

Show answers

Answers

Answer from: Quest

the diagram which shows forces as either balanced = same speed or unbalanced = accelerarting

Answer from: Quest

sleep paralysis is a parasomnia, events associated with sleep.

sleep paralysis happens when you are in the middle of waking up or falling asleep. it is the feeling of being conscious but unable to move. it definitely involves hallucinations.

i had a friend that had sleep paralysis and he told me a story one time where he was laying in bed and he couldn't move his body no matter how hard he tried and there was someone standing in the corner of his room coming towards him. he couldn't move and you can't "wake up" because you are already conscious. sometimes sleep paralysis can be triggered by frequent waking up during the night based off of multiple trips to the bathroom, or if you had ever been abused, sleep paralysis can start happening from things like that.

Answer from: Quest

powerful computers now, not then

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 20:00

You notice a very one-dimensional-thinking snail crawling along one rail of a railroad track. naturally, you remove it to a safer place. but before you do, you observe it as it moves from position xi = -92.9 cm to position xf = -64.9 cm along the rail, as measured from a point where one rail abuts the next. what is the snail\'s displacement δx in centimeters?

Answers: 1

Answer

Physics, 22.06.2019 04:00

Determine the maximum r-value of the polar equation r =3+3 cos 0

Answers: 1

Answer

Physics, 22.06.2019 14:00

An object resting on a table weighs 100 n. with what force is the object pushing on the table? with what force is the table pushing on the object? explain how you got your answer.

Answers: 1

Answer

Physics, 22.06.2019 18:30

Examples of states of consciousness include a. daydreaming b. dreaming during sleep c. hypnosis d. all of the above

Answers: 2

Answer

You know the right answer?

Question 2 2. what cause the rusting iron nails or iron made materials in a wet Cloth?
A. pre...

Questions