Physics, 17.10.2020 06:01 brandistrothma

A 2.5 kg mass starts from rest at point A and moves along the x-axis subject to the potential energy shine in the figure below (a) Determine the speed (in m/s) of the mass at point B, C,D (For each answer, enter a number)

(b) Determine the turning point of the mass. (Select all that apply.)
Point A
Point B
Point C
Point D
Point E

A 2.5 kg mass starts from rest at point A and moves along the x-axis subject to the potential energ

Answers: 2

Show answers

Answers

Answer from: mikaylarichardson96

With the use of K.E formula, the correct answers are:

a.) At point B, velocity = 2m/s

b.) At point C, velocity = 4m/s

C.) At point D, velocity = 3.5 m/s

POTENTION ENERGY

At maximum energy, total energy will be equal to maximum kinetic energy.

Given that a 2.5 kg mass starts from rest at point A and moves along the x-axis subject to the potential energy shown in the given figure.

Let us assume the that their maximum potential energies are given.

Total energy = maximum P.E = Maximum K.E

According to the graph, the P.E at point B,C, and D are:

Point B = 5J, distance = 4mPoint C = 20J, distance = 6mPoint D = 15J, distance = 15m

Since Maximum P.E = Maximum K.E = 1/2m $v^{2}$

At point B

5 = 1/2 x 2.5 x $v^{2}$

$v^{2}$ = 10/2.5

$v^{2}$ = 4

v = $\sqrt{4}$

v = 2 m/s

At point C

20 = 1/2 x 2.5 x $v^{2}$

$v^{2}$ = 40/2.5

$v^{2}$ = 16

v = $\sqrt{16}$

v = 4 m/s

At point D

15 = 1/2 x 2.5 x $v^{2}$

$v^{2}$ = 30/2.5

$v^{2}$ = 12

v = $\sqrt{12}$

v = 3.5 m/s

b.) The turning point should be any point where velocity is negative. Since there is no point where velocity is negative, let us consider the points where potential energy is increasing.

The turning points of the mass will be at point B and D

Learn more about Potential Energy here: link

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the force on the thing and the distance the force moves the thing

Another question on Physics

Physics, 21.06.2019 22:30

Curious carl calculated the density of a cube to be 4.50 g/cm3. what is the density of the cube in g/l?

Answers: 1

Answer

Physics, 22.06.2019 01:00

First, launch the video below. you will be asked to use your knowledge of physics to predict the outcome of an experiment. then, close the video window and answer the question at right. you can watch the video again at any point. part a as in the video, we apply a charge +q to the half-shell that carries the electroscope. this time, we also apply a charge â€“q to the other half-shell. when we bring the two halves together, we observe that the electroscope discharges, just as in the video. what does the electroscope needle do when you separate the two half-shells again? view available hint(s) as in the video, we apply a charge + to the half-shell that carries the electroscope. this time, we also apply a charge â€“ to the other half-shell. when we bring the two halves together, we observe that the electroscope discharges, just as in the video. what does the electroscope needle do when you separate the two half-shells again? it deflects more than it did at the end of the video. it deflects the same amount as at end of the video. it does not deflect at all. it deflects less than it did at the end of the video. submit

Answers: 2

Answer

Physics, 22.06.2019 03:00

An equinox occurs when a. neither end of earth's axis is tilted toward or away from the sun. b. the north end of earth's axis is tilted away from the sun. c. the north end of earth's axis is tilted toward the sun. d. earth's axis is parallel to the sun's rays. select the best answer from the choices provided a b c d

Answers: 1

Answer

Physics, 22.06.2019 06:30

Apebble is thrown into a calm lake, ripples are formed from the center and move outward. the water particles in the lake travel in a circular pattern that moves up and down on the surface of a lake, and the energy travels a) diagonally. b) downward. c) horizontally. d) upward.

Answers: 2

Answer

You know the right answer?

A 2.5 kg mass starts from rest at point A and moves along the x-axis subject to the potential energy...

Questions