Physics, 14.10.2020 01:01 edjiejwi

A race car is moving on a circular track with a radius of 50 kilometers. If the car's speed is 70 km/hr, determine the magnitude of the centripetal acceleration.
A. 3500 m/s^2
B. 1.4 m/s^2
C. 0.71 m/s^2
D. 98 m/s^2

Answers: 1

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

igneous rocks also form where plates converge. the subducting plate melts as it sinks into the crust of the earth, and the melt rises into the overriding plate forming volcanoes. metamorphic rocks are formed mainly in the lithosphere, wherever there is high pressure and high temperature. -woods

Answer from: Quest

force required to detach it is given by

$f = 4 * 10^{-8} n$

charges are taken to be fundamental charge

$q_1 = q_2 = 1.6 * 10^{-19}c$

now we have

$f = \frac{kq_1q_2}{r^2}$

$4 * 10^{-8} = \frac{9*10^9 * 1.6*10^{-19}* 1.6* 10^{-19}}{r^2}$

$r = 7.6 * 10^{-11} m$

so above is the minimum distance at which it will detach

Answer from: Quest

conservation of mass

mass before something happens = mass afterwards

Another question on Physics

Physics, 22.06.2019 06:30

The energy of a photon was found to be 3.38 × 10–19 j. planck’s constant is 6.63 × 10–34 j • s. which color of light corresponds to this photon?

Answers: 2

Answer

Physics, 22.06.2019 09:00

Abicycle slows down when the rider applies the brakes. what type of energy transformation is involved in this example? a. kinetic energy into heat energy b. heat energy into potential energy c. potential energy into kinetic energy d. kinetic energy into mechanical energy

Answers: 1

Answer

Physics, 22.06.2019 10:00

Which accurately compares concave and convex lenses?

Answers: 2

Answer

Physics, 22.06.2019 10:30

Avery long solenoid of inner radius 2.75 cm creates an oscillating magnetic field of the form = for this solenoid, =0.00425 t and =319 rad/s. (a)what is the maximum value of the induced electric field at a perpendicular distance 1.45 cm from the axis of the solenoid? (b) what is the maximum value of the inducted electric field at a point 5.85 cm perpendicular from the axis of the solenoid?

Answers: 1

Answer

You know the right answer?

A race car is moving on a circular track with a radius of 50 kilometers. If the car's speed is 70 km...

Questions

Physics, 30.12.2020 16:50

Why is dynamic friction is less thanlimiting friction?...

Physics, 30.12.2020 16:50

The graph shows water being heated from ice at −18 °C until it becomes a gas at a temperature above 100 °C. Explain why the specific heat equation, E...