Physics, 01.10.2019 16:00 safiyyahrahman6907

Once a falling object has reached a constant velocity, the object a. stops accelerating. b. stops speeding up. c. experiences equal forces of gravity and air resistance. d. all of the above

Answers: 2

Show answers

Answers

Once a falling object has reached a constant velocity, the object stops accelerating, it stops speeding up (which is the same as stopped accelerating), experiences equal forces of gravity and air resistance, so it's D.

Answer from: melissadelcid43

option D

Explanation:

When an object is falling, its speed increases due to the acceleration due to gravity but after travelling some distance, the air resistance comes into role and then the object attains a constant speed. It means the acceleration of body is zero. It stops speeding up.

It experiences an air resistance force which is equal to force of gravity.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

gravity

explanation:

Another question on Physics

Physics, 21.06.2019 14:20

The eel has a certain amount of rotational kinetic energy when spinning at 14 spins per second. if it swam in a straight line instead, about how fast would the eel have to swim to have the same amount of kinetic energy as when it is spinning?

Answers: 1

Answer

Physics, 21.06.2019 16:10

In 1995 a research group led by eric cornell and carl wiemann at the university of colorado successfully cooled rubidium atoms to the 20-200 nk temperature range. assuming (incorrectly) that the rubidium atoms behave liké particles of a classical ideal gas, calculate the rms speed of a rubidium atom at a temperature of 112.0 nk. in the experiments one particular isotope of rubidium was used, rubidium-87. the molar mass of this isotope is 86.91 q/mol. tries 0/20 submit answer

Answers: 1

Answer

Physics, 21.06.2019 21:40

Since the investigative question has two variables, you need to focus on each one separately. thinking only about the first part of the question, mass, what might be a hypothesis that would illustrate the relationship between mass and kinetic energy? use the format of "if…then…because…” when writing your hypothesis.

Answers: 1

Answer

Physics, 22.06.2019 01:30

The passing of heat through a material while the material itself stays in place. a. radiation b. conduction c. convection

Answers: 2

Answer

You know the right answer?

Once a falling object has reached a constant velocity, the object a. stops accelerating. b. stops s...

Questions