Physics, 07.10.2020 23:01 rileyeddins1010

A gun recoils while fireing a bullet?give reason!!

Answers: 2

Show answers

Answers

When a bullet is fired from a gun, the gun gives off a force on the bullet in the forward direction. The force is called the action force. The bullet also gives an equal and opposite force on the gun in the backward direction. That's why when bullets fire out, the force from the bullet also creates a force back.

Answer from: Quest

you cant move and you feel like someones pushing you down onto your bed it can feel like you want to get up but you just can't it can be extremely scary

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 07:30

Carbon-14 is a radioactive element that undergoes beta decay. which force is responsible for allowing carbon-14 to become stable? electromagnetic gravitational weak nuclear strong nuclear

Answers: 2

Answer

Physics, 22.06.2019 09:50

If an athlete runs once around a track, back to the starting line, her average velocity is zero. true or false?

Answers: 3

Answer

Physics, 22.06.2019 15:00

10 points! will mark brainiest! in a heat engine if 1,000 j of heat enters the system and the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2,000 j 1: write the equation 2: list out your known variables 3: plug the numbers into the equations 4: solve 5: write your solution statement that includes initial energy and final energy added you so much!

Answers: 3

Answer

Physics, 22.06.2019 15:50

The california mussel (mytilus californianus) attaches itself to a rock or other solid surface with a bundle of filaments known as the byssus. imagine that 15.0 j of work is done to stretch the distal end of the byssus. it releases 10.8 j of thermal energy as it relaxes. what is the resilience of the distal end of the byssus?

Answers: 2

Answer

You know the right answer?

A gun recoils while fireing a bullet?give reason!!...

Questions