A 3.50 cm tall object is held 24.8 cm from a lens of focal length 16.0 cm. What is the image height?

6.36 cm

Explanation:

Using the formula to first get the image distance

1/f = 1/u+1/v

f = focal length of the lens

u = object distance

v = image distance

Given f = 16.0 cm, u = 24.8 cm

1/v = 1/16 - 1/24.8

1/v = 0.0625-0.04032

1/v = 0.02218

v = 1/0.02218

v = 45.09 cm

To get the image height, we will us the magnification formula.

Mag = v/u = Hi/H

Hi = image height = ?

H = object height = 3.50 cm

45.09/24.8 = Hi/3.50

Hi = (45.09*3.50)/24.8

Hi = 6.36 cm

The image height is 6.36 cm

An  atom  (ours, not carroll's) consists of a positively charged  nucleus, surrounded by one or more negatively charged particles called  electrons. the positive charges equal the negative charges, so the atom has no overall charge; it is electrically neutral. most of an atom's mass is in its nucleus; the mass of an electron is only 1/1836 the mass of the lightest nucleus, that of hydrogen. although the nucleus is heavy, it is quite small compared with the overall size of an atom. the radius of a typical atom is around 0.1 to 0.25 nanometres (nm), whereas the radius of a nucleus is about 10-6  nm.  *  if an atom were enlarged to the size of the earth, its nucleus would be only 200 feet in diameter and could easily rest inside a small football stadium.read more on -

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o