Physics, 17.04.2020 05:21 madyson304

Calculate the linear acceleration of a car, the 0.260-m radius tires of which have an angular acceleration of 14.0 rad/s2. Assume no slippage and give your answer in m/s2. 3.64 Correct: Your answer is correct. m/s2 (b) How many revolutions do the tires make in 2.50 s if they start from rest

Answers: 1

Show answers

Answers

Answer from: alexandrecarmene

a. 3.64 m/s b. 7 revolutions

Explanation:

a. Linear acceleration

The linear acceleration,a = rα where r = radius of tyre = 0.260 m and α = angular acceleration = 14.0 rad/s².

a = rα = 0.260 m × 14.0 rad/s² = 3.64 m/s

b. Number of revolutions in 2.50 s

Using θ = ωt + 1/2αt² where θ = angular distance,ω = initial angular speed = 0(since it starts from rest) and t = 2.50 s

θ = 0 × 2.50s + 1/2(14.0 rad/s²)(2.50)² = 0 + 43.75 rad = 43.75 rad. So the number of revolutions is 43.75rad/2π = 6.96 revolutions ≅ 7.0 revolutions (since 1 revolution = 2π)

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

increase masses, decrease separation

Another question on Physics

Physics, 22.06.2019 23:00

Acommon technique in analysis of scientific data is normalization. the purpose of normalizing data is to eliminate irrelevant constants that can obscure the salient features of the data. the goal of this experiment is to test the hypothesis that the flux of light decreases as the square of the distance from the source. in this case, the absolute value of the voltage measured by the photometer is irrelevant; only the relative value conveys useful information. suppose that in part 2.2.2 of the experiment, students obtain a signal value of 162 mv at a distance of 4 cm and a value of 86 mv at a distance of 5.7 cm. normalize the students' data to the value obtained at 4 cm. (divide the signal value by 162.) then calculate the theoretically expected (normalized) value at 5.7 cm.

Answers: 2

Answer

Physics, 22.06.2019 23:30

Sound travels slower in colder air that it does in warmer air. make a claim about the effect of air temperature on the speed of sound. support your claim with evidence

Answers: 3

Answer

Physics, 23.06.2019 00:30

What is the technical name for super glue type adhesives?

Answers: 3

Answer

Physics, 23.06.2019 01:00

Two point charges are separated by a certain distance. how does the strength of the electric field produced by the first charge

Answers: 2

Answer

You know the right answer?

Calculate the linear acceleration of a car, the 0.260-m radius tires of which have an angular accele...