Physics, 26.03.2020 03:32 karatsgrande3772

A 3.6-liter, V6 SI engine is designed to have a maximum speed of 7000 RPM. There are two intake valves per cylinder, and valve lift equals one-fourth valve diameter. Bore and stroke are related as S = 1.06 B. Design temperature of the air-fuel mixture entering the cylinders is 60°C. Calculat!(: (a) Ideal theoretical valve diameter. [em] . (b) Maximum flow velocity through intake valve. [mIsec] (c) Do the valve diameters and bore size seem compatible?

Answers: 2

Show answers

Answers

To develop this problem, it will be necessary to apply geometric and energy relationships to calculate the velocities of the fluids as well as the dimensions of the Valve. We will start by calculating the volume displacement and rewrite this equation based on the Bore and Stroke. Later we will calculate the average speed of the piston and finally we will make the calculations of the required dimensions. Calculate displacement volume,

$V_d = \frac{3.6L}{6}$

$V_d = 0.6L (\frac{10^{-3}m^3}{1L})$

V_d = 0.0006m^3

Write the expression for displacement volume,

$V_d = \frac{\pi}{4}B^2S$

$0.0006 = \frac{\pi}{4}B^2(1.06B)$

The Bore will be,

B = 0.0897m

B = 8.97cm

The Stroke will be,

S = 1.06B

S = 1.06*8.97cm

S = 0.095m

S = 9.5m

Then the sonic velocity under this conditions will be,

$c = \sqrt{kRT}$

$c = \sqrt{1.4(287)(273+60)}$

c = 366m/s

Calculate the avarage piston speed at maximum speed

$(U_p)_{max} = 2SN$

$(U_p)_{max} = 2 (0.095m/stoke)(\frac{7000}{60}rev/s)$

$(U_p)_{max} = 22.17m/s$

Calculate total intake valve area using the following relation

$A = 1.3B^2 (\frac{U_p{max}}{c_1})$

$A = (1.3)(8.97)(\frac{22.17}{366})$

A = 6.34cm^2

Calculate area of the one valve,

$A_1 = \frac{A}{2}$

$A_1 = \frac{6.34}{2}$

A_1 = 3.17cm^2

PART A) Calculate the ideal thermotical valve diameter,

$A_i = \frac{\pi}{4} d_v^2$

$3.17 = \frac{\pi}{4}d_v^2$

d_v = 2.01cm

PART B) Calculate maximum flow velocity through intake

$V_{max} = c$

$V_{max} = 366m/s$

PART C) Comparing both dimension not are equal.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

thermal energy is the answer

Another question on Physics

Physics, 21.06.2019 21:30

Ahydroelectric plant takes energy from water and turns it into electrical energy. what are the transformations of energy in the water molecules that are used in the process of generating electricity this way?

Answers: 3

Answer

Physics, 22.06.2019 02:30

If a refrigerator is a heat pump that follows the first law of thermodynamics, how much heat was removed from food inside of the refrigerator if it released 380j of energy to the room?

Answers: 1

Answer

Physics, 22.06.2019 21:10

How do you know how many valence electrons an atom has?

Answers: 1

Answer

Physics, 22.06.2019 23:20

What describes the particles in a liquid

Answers: 1

Answer

You know the right answer?

A 3.6-liter, V6 SI engine is designed to have a maximum speed of 7000 RPM. There are two intake valv...