Physics, 13.03.2020 04:57 poohmoney

When the input voltages of a difference amplifier are 5.1 v and 6.4 v, the output voltage is 64.7 v. The inputs are changed to 4.9 v and 5.6 v, and the output voltage changes to 35.7 v. What are the common mode gain, differential mode gain and CMRR for this difference amplifier

Answers: 2

Show answers

Answers

Answer from: heyysn3858

a) Differential mode gain = 48

b) Common mode gain = 0.4

c) CMRR = 120

Explanation:

The output of a difference amplifier is related to the input by the equation:

$V_{0} = A_{1} V_{1} + A_{2} V_{2} \\$

When V₁ = 6.4 V, V₂ = 5.1 V and V₀ = 64.7 V, the equation becomes

6.4 A₁ + 5.1 A₂ = 64.7.....................(1)

When V₁ = 5.6 V, V₂ = 4.9 V and V₀ = 35.7 V, the equation becomes

5.6 A₁ + 4.9 A₂ = 35.7.....................(2)

Multiply equation (1) by 5.6 and (2) by 6.4

35.84 A₁ + 28.56A₂ = 362.32.....................(3)

35.84 A₁ + 31.36 A₂ = 228.48....................................(4)

Subtract equation (3) from (4)

2.8 A₂ = -133.84

A₂ = -133.84/2.8

A₂ = -47.8

Put the value of A₂ into equation (1)

6.4 A₁ + 5.1 (-47.8) = 64.7

6.4 A₁ = 64.7 + 243.78

A₁ = 308.48/6.4

A₁ = 48.2

a) Common mode gain = A₁ + A₂ = 48.2 + (-47.8)

Common mode gain = 0.4

b) Differential mode gain = (A₁ -A₂)/2

Differential mode gain = (48.2 - (-47.8))/2

Differential mode gain = 96/2

Differential mode gain = 48

c) Common Mode Rejection Ratio (CMRR)

$CMRR = |\frac{Differential Mode Gain}{Common Mode Gain} |$

$CMRR = |\frac{48}{0.4} |\\CMRR = 120$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

The correct answer is c. hope this

Another question on Physics

Physics, 22.06.2019 03:30

Using a wheel and axle, a farmer is trying to lift a bucket of water from the bottom of a well. the larger wheel has a radius of 40 cm compared to the axle that has a radius of 10 cm. if a bucket of water is 50 n, then how much effort is required to raise it? 12.5 n 200 n 2 n 500 n

Answers: 1

Answer

Physics, 22.06.2019 08:30

If an astronaut takes an object to the moon the following is true (choose only one). a the mass will change but the weight will be the same. b both the mass and the weight of the object will be the same. c the weight will change but the mass will be the same. d both the mass and the weight of the object will change.

Answers: 1

Answer

Physics, 22.06.2019 14:30

Increasing the pressure on one spot of a fluid will increase the pressure everywhere else in the fluid a. pascals principal b. archimedes' principal c. bernoulli's principal

Answers: 1

Answer

Physics, 22.06.2019 18:00

Astudent pushes a 60-n block across the floor for a distance of 10 m. how much work was done to move the block

Answers: 1

Answer

You know the right answer?

When the input voltages of a difference amplifier are 5.1 v and 6.4 v, the output voltage is 64.7 v....

Questions