Physics, 10.03.2020 09:15 magicalforlife

If the loop sits in a uniform magnetic field of 3.5~T3.5 T that is oriented in the horizontal +x direction, what is the magnitude of the torque on the wire loop?

Answers: 1

Show answers

Answers

Answer from: Andrewecolt1993

The magnitude of the torque on the wire loop is 3.68 Nm.

Explanation:

Given that,

Magnetic field = 3.5 T

Suppose, A circular wire loop with a radius of 62.7 cm lies flat in the horizontal x-y plane and contains a current of 852 mA that runs counter-clockwise in the wire loop when viewed from above.

We need to calculate the area

Using formula of area

$A=\pi r^2$

Put the value into the formula

$A=\pi\times(62.7\times10^{-2})^2$

$A=1.235\ m^2$

We need to calculate the magnitude of the torque on the wire loop

Using formula of magnetic field

$\tau=NIAB\sin90$

Put the value into the formula

$\tau=1\times852\times10^{-3}\times1.235\times3.5\times1$

$\tau=3.68\ Nm$

Hence, The magnitude of the torque on the wire loop is 3.68 Nm.

Answer from: Quest

sleep paralysis is a parasomnia, events associated with sleep.

sleep paralysis happens when you are in the middle of waking up or falling asleep. it is the feeling of being conscious but unable to move. it definitely involves hallucinations.

i had a friend that had sleep paralysis and he told me a story one time where he was laying in bed and he couldn't move his body no matter how hard he tried and there was someone standing in the corner of his room coming towards him. he couldn't move and you can't "wake up" because you are already conscious. sometimes sleep paralysis can be triggered by frequent waking up during the night based off of multiple trips to the bathroom, or if you had ever been abused, sleep paralysis can start happening from things like that.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 23:40

What is meant by the statement" the melting poin of glycerine is 13 degree celsius

Answers: 3

Answer

Physics, 22.06.2019 11:30

1. a camcorder has a power rating of 19 watts. if the output voltage from its battery is 7 volts, what current does it use?answer units 2. a 1.5m wire carries a 6 a current when a potential difference of 57 v is applied. what is the resistance of the wire? yourunits 3. a clothes dryer uses about 2 amps of current from a 240 volt line. how much power does it use? yourunits 4.

Answers: 1

Answer

Physics, 22.06.2019 13:40

An ideal otto cycle has a compression ratio of 10.5, takes in air at 90 kpa and 40°c, and is repeated 2500 times per minute. using constant specific heats at room temperature, determine the thermal efficiency of this cycle and the rate of heat input if the cycle is to produce 90 kw of power.

Answers: 2

Answer

Physics, 22.06.2019 19:30

The ability to make things happen is also called a. heat b. force c. matter d. energy

Answers: 1

Answer

You know the right answer?

If the loop sits in a uniform magnetic field of 3.5~T3.5 T that is oriented in the horizontal +x dir...

Questions