Physics, 07.01.2020 05:31 bm42400

Does visible light make up a relatively large part or a relatively small part of the electromagnetic spectrum?

Answers: 1

Show answers

Answers

Answer from: aesthetickait

Relatively small part of the electromagnetic spectrum

Explanation:

Let us take a look at the electromagnetic spectrum

Radio waves

Wavelength = $10^3\ m$

Microwaves

Wavelength = $10^{-2}\ m$

Infrared waves

Wavelength = $10^{-5}\ m$

Visible waves

Wavelength = $0.5\times 10^{-6}\ m$

Radio waves

Wavelength = $10^3\ m$

Ultraviolet waves

Wavelength = $10^{-8}\ m$

X ray waves

Wavelength = $10^{-10}\ m$

Gamma ray waves

Wavelength = $10^{-12}\ m$

So, it can be seen that the visible light makes up a relatively small part of the electromagnetic spectrum.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

neither accurate nor precise.

Another question on Physics

Physics, 21.06.2019 13:50

Aboat that travels with constant speed of 6.10 m/s in still water is to go directly across a river. the current in the river flows at 1.95 m/s. (a) at what angle must the boat be steered?

Answers: 1

Answer

Physics, 22.06.2019 04:30

You are traveling in a car going at a constant speed of 100km/h down a long, straight highway. you pass another car going in the same direction which is traveling at a constant speed of 80km/h. as measured from your car's reference frame this other car is traveling at −20km/h. what is the acceleration of your car as measured from the other car's reference frame? what is the acceleration of the other car as measured from your car's reference frame?

Answers: 2

Answer

Physics, 22.06.2019 04:50

Find v(t), given acceleration a(t)=7j and initial velocity v(0)=k

Answers: 2

Answer

Physics, 22.06.2019 05:50

High schoolphysics 5+3 pts a neon light consists of a glass tube with metal wires at each end. when connected to a high-voltage source, the gas glows. if a fly lands on the glass tube, what will most likely happen? a) the fly will not feel a shock because the glass conducts any free electrons back into the gas. b) electrons will flow directly from the metal wires along the glass and shock the fly. c) the fly will not feel a shock because the glass insulates it from the electrons in the gas and the metal. d) electrons that are moving through the gas will be conducted through the glass and shock the fly.

Answers: 3

Answer

You know the right answer?

Does visible light make up a relatively large part or a relatively small part of the electromagnetic...

Questions