Physics, 12.11.2019 02:31 brittanysanders

The speed of sound in wood is the speed of sound in water.

Answers: 2

Show answers

Answers

Answer from: 120175

greater

Explanation:

the speed of sound in steel is greater than water. the speed of sound in wood is not, In water, the particles are much closer together, and they can quickly transmit vibration energy from one particle to the next. This means that the sound wave travels over four times faster than it would in air, but it takes a lot of energy to start the vibration.

Wood is less dense and force can make a sound.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

firearm identification is the process of analyzing the bullets and cartridge cases left at a crime scene to determine if they came from a particular firearm. marks on the bullets and cartridges may be common to every firearm of that type. these are called class characteristics.

Another question on Physics

Physics, 21.06.2019 14:00

What mass will a pumpkin have a force of 450 newton’s accelerates it to 110 m/s^2? include the correct units.

Answers: 1

Answer

Physics, 22.06.2019 00:10

The summit of chimborazo, in ecuador, which is at a distance of about 6,384 km from the earth’s center. the bottom of the mariana trench, in the western pacific ocean, which is nearly 6,370 km from the center of the earth. on the surface of earth on the equator line.

Answers: 2

Answer

Physics, 22.06.2019 04:00

Determine the maximum r-value of the polar equation r =3+3 cos 0

Answers: 3

Answer

Physics, 22.06.2019 12:00

In an experiment, how can i change human errors? be specific.

Answers: 1

Answer

You know the right answer?

The speed of sound in wood is the speed of sound in water....