Two atoms collide while moving in a dilute gas. the larger atom has a mass m1 = 6 daltons and a speed v1 = 200 m/s, while the smaller has a mass m2 = 1 daltons. during the collision both atoms simply bounce off each other. they do not change their speeds, but after the collision they each change their directions, bouncing in the indicated directions. (you may express your results using the mass unit "daltons". 1 dalton is approximately equal to the mass of a proton or neutron and is defined as one-twelfth the mass of a single neutral carbon-12 atom in its ground state.)
a. what is the magnitude of the change in the momentum, δp1, of mass m1?
b. what is the change in the total momentum of the pair?
c. what is the magnitude of the change in the momentum δp2, of mass m2?

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o