Physics, 02.10.2019 04:00 katherineweightman

Asolid silver sphere of radius a = 2.5 cm has a net charge qin = - 3.0 mc. the sphere is surrounded by a concentric copper spherical shell of inner radius b = 6.0 cm and outer radius c = 9.0 cm. the shell has a net charge qout = +2.0 mc. a) what is the electric potential at the outer edge of the copper shell, given the potential at infinity is zero? b) what is the electric potential on the inner edge of the copper shell? c) what is the electric potential at the center of the silver sphere?

Answers: 1

Show answers

Answers

Answer from: cheergirlkr4746

Part a)

tex]V = -1 \times 10^8 Volts[/tex]

Part b)

$V_{inner} = V_{outer} = -1 \times 10^8 volts$

Part c)

$V = -7.30 \times 10^8 Volts$

Explanation:

Part a)

Net charge distribution on each shell is given as

On surface of radius "a"

q_a = -3.0 mC

on radius "b"

q_b = 3 mC

on radius "c"

q_c = -1.0 mC

Now potential at the outer shell is

$V = \frac{kq_c}{r_c}$

$V = \frac{(9\times 10^9)((-1\times 10^{-3})}{0.09}$

$V = -1 \times 10^8 Volts$

Part b)

Since copper sphere is a conducting sphere so here it will be an equi potential surface

So the potential will remain same throughout the surface of this sphere

Now we can say

$V_{inner} = V_{outer} = -1 \times 10^8 volts$

Part c)

Now electric potential at inner sphere is given as

$V = \frac{kq_a}{r_a} + \frac{kq_b}{r_b} + \frac{kq_c}{r_c}$

$V = \frac{(9\times 10^9)(-3 mC)}{0.025} + \frac{(9\times 10^9)(3 mC)}{0.06} + \frac{(9\times 10^9)(-1 mC)}{0.09}$

$V = -7.30 \times 10^8 Volts$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

i'm on my way to history not a mistory.

Another question on Physics

Physics, 22.06.2019 00:30

Next a skier is pulled by a tow rope up a frictionless ski slope that makes an angle of 15 with the horizontal. the rope moves parallel to the slope with a constant speed of 0.69 m/s. the force of the rope does 800 3 of work on the skier as the skier moves a distance of 8.4 m up the incline. (a) if the rope moved with a constant speed of 2.2 m/s how much work would the force of the rope do on the skier as the skler moved a distance of 8.4 m up the incline? at what rate is the force of the rope doing work on the skier when the rope moves with a speed of (b) 0.69 m/s and (c) 2.2 m/s?

Answers: 1

Answer

Physics, 22.06.2019 04:40

How is the gravitational force related to the distance between two objects?

Answers: 1

Answer

Physics, 22.06.2019 13:30

The two stars in a certain binary star system move in circular orbits. the first star, alpha, has an orbital speed of 36 km/s. the second star, beta, has an orbital speed of 12 km/s. the orbital period is 137 d. a) what is the mass of the star alpha? b) what is the mass of the star beta?

Answers: 1

Answer

Physics, 22.06.2019 18:00

Which of the following is not a physical property of mattera. melting pointb.heat of combustionc. viscosityd. boiling point

Answers: 1

Answer

You know the right answer?

Asolid silver sphere of radius a = 2.5 cm has a net charge qin = - 3.0 mc. the sphere is surrounded...

Questions