(oss.01)
a student explains the nebular theory of formation of the solar system as follows.
"the solar system was formed from a slowly rotating cloud called nebula containing extremely cold gases. when these gases were heated up, the nebula contracted and became a flattened disk. as the nebula became smaller, it rotated more rapidly and became flattened at the poles. gravitational force caused rings of gases to be left behind when the nebula contracted. at the center of the nebula, the gases combined to form the sun and the planets formed in the outer flattened portion of the disk."
what is the flaw in the student's explanation? (1 point)
a gravitational forces did not the nebula to contract
b the nebula consisted of hot gases which contracted on being cooled
c the speed of rotation of the nebula decreased when it became smaller
d planets were formed in the central core of the nebula instead of outer portion of disk

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Answerthe global climate during the paleogene departed from the hot and humid conditions of the late mesozoic era and began a cooling and drying trend which dispite having been periodically disrupted by warm periods such as the paleocene-eocene thermal maximum, persists today;