Physics, 09.08.2019 03:30 marykayy0218own5cp

Why do astronomers place telescopes in earth’s orbit? what are the advantages for the different regions of the spectrum?

Answers: 3

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

jupiter is the largest planet in our solar system, having a mass and radius that are respectively, 318 and 11.2 times that of earth. suppose that an object falls from rest near the surface of each planet and that the acceleration due to gravity remains constant during the fall. each object falls the same distance before striking the ground. determine the ratio of the time of fall on jupiter to that on earth.

Answer from: Quest

The magnets are probably damaged or there not strong enough to attached to the refrigerator

Answer from: Quest

the design of a ski jumping suit involves a trade-off between giving the skiers lift to get higher jumps and ensuring the skier does not face a lot of drag before the jump itself. an expansive suit may to lift the skier higher, but at the same time, it will also increase the air resistance. higher air resistance as the skier goes down the slope limits the speed of the jump. a big suit also increases the risk of losing balance or control, especially if there's a strong gust of wind. while technologically enhanced suits a lot, clothing is not the only factor in a ski jumper’s success. gathering speed while skiing down the slope, ensuring good speed on the ramp, and maintaining good body posture and form in the air all contribute to a ski jumper's success.

Another question on Physics

Physics, 22.06.2019 03:00

Arotating space station is said to create “artificial gravity”—a loosely-defined term used for an acceleration that would be crudely similar to gravity. the outer wall of the rotating space station would become a floor for the astronauts, and centripetal acceleration supplied by the floor would allow astronauts to exercise and maintain muscle and bone strength more naturally than in non-rotating space environments. if the space station is 200 m in diameter, what angular velocity would produce an “artificial gravity” of 9.80 m/s^{2} 2 at the rim?

Answers: 3

Answer

Physics, 22.06.2019 09:40

When you jump from an elevated position you usually bend your knees upon reaching the ground. by doing this, you make the time of the impact about 10 times as great as for a stiff-legged landing. in this way the average force your body experiences is a) less than 1/10 as great. b) more than 1/10 as great. c) about 1/10 as great.d) about 10 times as great.

Answers: 1

Answer

Physics, 22.06.2019 17:30

When using the scientist method, which step comes last?

Answers: 2

Answer

Physics, 23.06.2019 00:20

You are the coordinator for a program that is going to take place at night in a rectangular amphitheater in the mountains. you will have no access to any electricity, but you must be able to illuminate the entire grounds. you know the intensity of the light from a lantern varies inversely as the square of the distance from the lantern. suppose the intensity is 90 when the distance is 5 m. a. write an equation to model the situation. b. solve for the constant of variation. c. write the equation to model the situation using the constant () of variation. d. you have been given lanterns with 40 light intensity. use your equation to solve for the distance from the lantern. e. you need to illuminate 225 km. how many meters do you need to light? f. how many lanterns will you need?

Answers: 3

Answer

You know the right answer?

Why do astronomers place telescopes in earth’s orbit? what are the advantages for the different reg...

Questions