Physics, 25.12.2019 16:31 peralesdavid34

Asound wave has a speed of 343 m/s in air. what is the wavelength of a sound wave with a frequency of 686 hz

Answers: 2

Show answers

Answers

Answer from: jaymieordonez8751

Wavelength is the distance between 2 adjacent points in a wave

we can use the following equation to find the wavelength of a sound wave

wavelength = speed / frequency

frequency is the number of waves passing a point in 1 second

substituting the values in the equation

wavelength = 343 m/s / 686 Hz

wavelength = 0.5 m

wavelength of the wave is 0.5 m

Answer from: Quest

explanation:

could i give you a exaplo that could you?

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 17:20

If you were to drop a rock from a tall building, assuming that it had not yet hit the ground, and neglecting air resistance. what is its vertical displacement (in m) after 6 s?

Answers: 1

Answer

Physics, 22.06.2019 00:50

Part a constants huck finn walks at a speed of 0.60 m/s across his raft (that is, he walks perpendicular to the raft's motion what is huck's velocity (speed and direction) relative to the river bank? express your answer to three significant figures and include the appropriate units. relative to the shore)

Answers: 3

Answer

Physics, 22.06.2019 16:00

What is the freezing point of radiator fluid that is 50% antifreeze by mass? kf for water is 1.86 ∘c/m.

Answers: 3

Answer

Physics, 22.06.2019 23:00

Determine the force the sun exerts on an object with a mass of 80.0 kg if that object is on the earth. what is the force exerted by the moon on the same object? what is the force the earth exerts on it?

Answers: 1

Answer

You know the right answer?

Asound wave has a speed of 343 m/s in air. what is the wavelength of a sound wave with a frequency o...

Questions