Physics, 02.07.2019 21:30 Serenitybella

What happens when two forces act in the same direction? a. they cancel each other out. b. they are added together. c. they are subtracted. d. their sum divided by two is the total force.

What happens when two forces act in the same direction? a. they cancel each other out. b. they are

Answers: 2

Show answers

Answers

Answer from: ochoachanna

Using the picture provided the forces are added together, because they are putting force on an object the same direction, thus the forces are added.

Answer from: potatogirl6811

The two forces are added when in hook ground the same direction

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

energy can be converted from one form to another, but it cannot be created or destroyed in ordinary chemical or physical means. do not understand what you are asking but hope this

Another question on Physics

Physics, 22.06.2019 04:30

True or false when elements combine to form a mixture, the resulting chemical properties may be very different from those of the elements that make it.

Answers: 2

Answer

Physics, 22.06.2019 18:30

Aballoon is rising vertically upwards at a velocity of 10m/s. when it is at a height of 45m from the ground, a parachute bails out from it. after 3s he opens his parachute and decelerates ata a constant rate 5m/s.when. (a) what was the height of the parachutist above the ground when he opened his parachute? (b)how far is the parachutist from the balloon at t=3s? (c)with what velocity does the parachutist hit the ground? (d)after how long does the parachutist hit the ground after his exist from the balloon?

Answers: 3

Answer

Physics, 22.06.2019 19:00

Friction removes energy from objects in motion. which statement best describes how this works? a) friction transforms ke into thermal energy b) friction transfers thermal energy to ke c) friction transforms te into pe d) friction transforms pe into ke e) friction transfers ke into pe

Answers: 1

Answer

Physics, 22.06.2019 20:30

Avehicle accelerates from 0 to 30 m/s in 10 seconds on a straight road

Answers: 2

Answer

You know the right answer?

What happens when two forces act in the same direction? a. they cancel each other out. b. they are...

Questions