Physics, 14.07.2019 04:30 leslieguerrero2225

Achild is sitting on the outer edge of a merry-go-round that is 18 m in diameter. if the merry-go-round makes 5.9 rev/min, what is the velocity of the child in m/s?

Answers: 1

Show answers

Answers

Answer from: Anonymouslizard

The velocity of the kid is 5.6 m/s

Explanation: Ok, the velocity of the kid will be:

v = w*r

where r is the radius, and w is the frequency.

We know that the diameter is 18m, and the diameter is equal to two times the radius. So r = 18m/2 = 9m

Now, we know that the circumference of a circle is equal to c = 2pi*r, so each revolution has this length, if the kid does 5.9 revolutions in one minute, then the kid spins at v = 5.9*2pi*9m/min

But we want to write this in meters per second, this means that we need to divide it by 60.

v = (5.9*2pi*9/60)m/s = 5.56 m/s

Answer from: Quest

an enlarged virtual image

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 00:30

Part f - example: finding two forces (part i) two dimensional dynamics often involves solving for two unknown quantities in two separate equations describing the total force. the block in (figure 1) has a mass m=10kg and is being pulled by a force f on a table with coefficient of static friction îľs=0.3. four forces act on it: the applied force f (directed î¸=30â above the horizontal). the force of gravity fg=mg (directly down, where g=9.8m/s2). the normal force n (directly up). the force of static friction fs (directly left, opposing any potential motion). if we want to find the size of the force necessary to just barely overcome static friction (in which case fs=îľsn), we use the condition that the sum of the forces in both directions must be 0. using some basic trigonometry, we can write this condition out for the forces in both the horizontal and vertical directions, respectively, as: fcosî¸â’îľsn=0 fsinî¸+nâ’mg=0 in order to find the magnitude of force f, we have to solve a system of two equations with both f and the normal force n unknown. use the methods we have learned to find an expression for f in terms of m, g, î¸, and îľs (no n).

Answers: 2

Answer

Physics, 22.06.2019 12:30

What is the equation for electrical work?

Answers: 3

Answer

Physics, 22.06.2019 17:00

Amajor difference radio waves, visible light, and gamma rays is the of the photons, which results in different photon frequencies and wavelengths

Answers: 1

Answer

Physics, 22.06.2019 18:00

Astudent weighing 700 n climbs at constant speed to the top of an 8 m vertical rope in 10 s. the average power expended by the student to overcome gravity is most nearly

Answers: 2

Answer

You know the right answer?

Achild is sitting on the outer edge of a merry-go-round that is 18 m in diameter. if the merry-go-ro...

Questions