CH3CHClCH(CH3)CH2CH2CH2CH2Br name the molecule iupac rules please

Subduction zones occur on earth where dense oceanic crust dives under more buoyant continental crust. these boundaries are characterized by a deep ocean trench next to a high continental mountain range, large numbers of earthquakes and volcanoes. all of this is further evidence for the a) big bang theory b) origin of the species eliminate c theory of plate tectonics d theory of natural selection 4 sedimentary rocks found high in the himalayen mountain

Determine the energy released per kilogram of fuel used. given mev per reaction, calculate energy in joules per kilogram of reactants. consider 1 mole of tritium plus 1 mole of deuterium to be a mole of “reactions” (total molar mass = 5 grams).

Identify the electromagnets with poles that are reversed from the electromagnet shown above