Chemistry, 26.03.2021 20:30 khaylaperry
1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic acid.
CH3CH2CH2COOH+CH3CH(CH3)NH2⟶
2.)Give the systematic (IUPAC) names for these molecules.
This molecule has the condensed formula C H 3 C H 2 C O O (C 6 H 5). C 6 H 5 is a benzene ring.
IUPAC name
Answers: 2
Chemistry, 22.06.2019 11:00
Ais a mountain created from eruptions of lava, ash, rocks, and hot gases.
Answers: 1
Chemistry, 23.06.2019 00:00
(04.05 hc) analyze the given diagram of the carbon cycle below. part 1: which compound does c represent? part 2: name a process that could release this compound into the air. part 3: explain how the elements that form it are conserved during the carbon cycle. use complete sentences to explain your answer. justify how this compound was created from a recycling of carbon in the carbon cycle. use complete sentences to explain your answer.
Answers: 3
Chemistry, 23.06.2019 00:10
Find the missing probability in the table below a.0.10 b.40 c.0.80 d. 0.20
Answers: 2
1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic aci...
Mathematics, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01
History, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01
History, 13.10.2020 04:01
Biology, 13.10.2020 04:01
Geography, 13.10.2020 04:01
Mathematics, 13.10.2020 04:01