1.) Draw the amide formed when 1‑methylethylamine (CH3CH(CH3)NH2) is heated with each carboxylic acid. CH3CH2CH2COOH+CH3CH(CH3)NH2⟶

2.)Give the systematic (IUPAC) names for these molecules.

This molecule has the condensed formula C H 3 C H 2 C O O (C 6 H 5). C 6 H 5 is a benzene ring.

IUPAC name

Ais a mountain created from eruptions of lava, ash, rocks, and hot gases.

(04.05 hc) analyze the given diagram of the carbon cycle below. part 1: which compound does c represent? part 2: name a process that could release this compound into the air. part 3: explain how the elements that form it are conserved during the carbon cycle. use complete sentences to explain your answer. justify how this compound was created from a recycling of carbon in the carbon cycle. use complete sentences to explain your answer.

Me as soon as possible! me as soon as possible!