Draw this molecule in the form of bond line figure.

CHOCH2CH(CH2CH3)CON(CH3)2

98 ! and brainliest plz ! the below reaction can be categorized as more than one type of reaction. which reactions are these, and what are the types of reactions?

What type of reaction is shown below? check all that apply. 2h2o2 → 2h2o + o2 synthesis decomposition combustion

Astudent is trying to create a table that compares hypotheses, theories, and laws. hypothesis theory law do scientific researchers formulate it? yes yes yes does it explain why things happen? yes yes no yes yes yes is it used to make predictions? no yes yes which of the following questions would most likely fill the blank in the table? is it an intelligent guess? is it newly formulated? is it based on observations? has it been proved?