Write the equilibrium expression of each chemical equation.
2H2S(g) 2H2(g) + S2(g)

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

what are the choices?

the density(ratio between mass and volume as m/v) decreases from top to bottom in periodic table group as the size increases and nuclear charge decreases. but in periods density increases from left to right as atom size decreases and nuclear charge increases.