Ethers and alcohols can be isomeric. Write the structures, and give names for all possible isomers with the molecular formula C6H14O. 2 Write equations for the best method to prepare each of the following ethers

a CH3CH2CH(CH3)CH2OCH2CH(CH3)2

b (CH3)2CHCH2OCH2CH(CH3)2

answer is: nuclear fusion produces elements that are heavier than helium.

nuclei combine to form a heavier nucleus, releasing energy.  

for example, fusion of hydrogen atoms at the sun.  

this fusion nuclear reaction is in the inner core of the sun and hydrogen (atomic number 1) is conveted into helium (atomic number 2).  

the inner core is the central region of the sun and all solar energy is produced in the core by nuclear fusion.