subject
Chemistry, 14.01.2020 07:31 NeonPlaySword

Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)

ansver
Answers: 3

Another question on Chemistry

question
Chemistry, 22.06.2019 07:00
6what is the importance of water on earth? a) it keeps the top layer of the geosphere cool b) it allows life to exist c) it provides ice at the poles d) it creates earth's blue color from space
Answers: 2
question
Chemistry, 22.06.2019 07:20
Why does his teacher ask him to balance the equation by including the correct coefficient
Answers: 1
question
Chemistry, 22.06.2019 08:30
Agroup of students is studying convection current. they fill two identical balloons with the same amount of helium. one balloon is placed in a freezer and the other is in an area with warm air. after 10 minutes, the balloon are released from a height of 1 meter. which of the following to the students most likely observe? a) the warm balloon expands and rises. the cold balloon shrinks and sinks b) the balloon both rise. the cold balloon is larger than the warm balloon c) the cold balloon expands and rises. the warm balloon shrinks and sinks d) the balloon rise at the same rate. both balloons are the same size
Answers: 1
question
Chemistry, 23.06.2019 02:00
Which best describes the present-day universe? opaque, expanding very slowly, stars produce heavy elements transparent, expanding at an accelerated rate, stars produce heavy elements opaque, expanding at an accelerated rate, stars produce only hydrogen and helium transparent, expanding very slowly, stars produce only hydrogen and helium
Answers: 1
You know the right answer?
Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)...
Questions