What is the molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid.

caco3(s)+2ch3cooh(aq) → ca(ch3coo)2(aq)+h2o(l)+co2(g)

caco3(s)+ch3cooh(aq) → cach3coo(aq)+h2o(l)+co2(g)

caco3(s)+2ch3cooh(aq) → ca(ch3coo)2(s)+h2o(l)+co2(g)

caco3(s)+ch3cooh(aq) → cach3coo(s)+h2o(l)+co2(g)

The molecular equation for the reaction of CaCO₃ with CH₃COOH is:

CaCO₃ (s) + 2CH₃COOH (aq) → Ca(CH₃COO)₂ (aq) + H₂O (l) + CO₂ (g)

Option 1

Explanation:

CaCO₃ + 2CH₃COOH → Ca(CH₃COO)₂ + H₂O + CO₂

Option 3 is the same equation as option 1, but calcium acetate, does not precipitate, so the formed salt, is not a solid.

Option 2 and 4 are wrong because calcium acetate molecular formula is

Ca(CH₃COO)₂

Ca(CH₃COO)₂  → Ca²⁺  +   2 CH₃COO⁻

the equation that correctly represent the reaction for formation of ammonia is

n2+ 3h2 → 2nh3 (answer d)

1 mole of nitrogen gas (n2) react with 3 moles of hydrogen gas (h2) to form 2 moles of ammonia ( nh3). this is in a process known as haber process were iron is used as a catalyst and reaction take place that a higher temperature and pressure. the process is exothermic hence energy is released.