Chemistry, 18.12.2019 20:31 memorybuxton
When comparing the ir spectra of the two compounds below, what absorption(s) would allow you to distinguish the compounds? hc≡cch2n(ch2ch3)2andch3(ch2)5c≡n strong, broad peak at 3600−3200 cm−1 medium peak at 3500−3200 cm−1 medium peak at 3300 cm−1 medium peak at 3150−3000 cm−1 strong peak at 3000−2850 cm−1 medium peak at 2250 cm−1 strong peak at ~1700 cm−1 medium peak at at 1650 cm−1 medium peak at 1600, 1500 cm−1 no distinguishing peaks
Answers: 1
Chemistry, 22.06.2019 02:00
Write a hypothesis that answers the lesson question, “while observing a chemical reaction, how can you tell which reactant is limiting? ” hypothesis: if a substance is the limiting reactant, then . . because . .
Answers: 1
Chemistry, 22.06.2019 05:00
As you watch a surfer ride a wave towards the shoreline, what is the shoreline? a) displacement reference b) reference point c) coordinate plane d) cartesian boundary
Answers: 1
Chemistry, 22.06.2019 16:00
The chemical equation below shows the reaction of sodium (na) and chlorine (cl) to form sodium chloride (nacl). 2na + cl2 → 2nacl in this equation, which of the following is a reactant? i. sodium ii. chlorine iii. sodium chloride
Answers: 1
Chemistry, 22.06.2019 20:00
State one important difference between a physical change and a chemical change?
Answers: 1
When comparing the ir spectra of the two compounds below, what absorption(s) would allow you to dist...
Health, 27.07.2019 20:50
History, 27.07.2019 20:50
Social Studies, 27.07.2019 20:50
Health, 27.07.2019 20:50
Biology, 27.07.2019 20:50
Biology, 27.07.2019 20:50
Social Studies, 27.07.2019 20:50