Convert the condensed structures to line angle formulas: 1. ch3ch2ch(ch3)ch2ch3 8. ch: coch 9. ch3ch2och3 2. ch3ch2ch(ch2ch3)ch(ch3)ch2cho ch)ch: ch-ch: 10. ch ch2ch=c(ch: ch)(c(ch))ch 3. ch3ch2ch(ch3)ch(ch3)ch2ch3 11. ch: ch-ch(ch2ch)ch oh 4. ch3c(ch3)2ch2ch2ch(ch3)ch2ch3 12. chchoch2cho 5. ch(ch3)2ch(ci)ch2ch3 13. hoocch2nhch(ch3)coch; 6. ch3ch2choch(ch2ch3)ch2ch3 14. hoocch och cooh 7. hoch: c(ch3)2conh2

Attached in the photo.

Explanation:

Hello,

The answers in the attached photo. Just three things:

- In the second point a parenthesis is missing to properly understand the molecule (after the oxygen), nevertheless, I assumed it was an ether.

- In the sixth point, there's a missing hydrogen for it to be an ether as well.

- In the tenth point the second parenthesis is not clear, it seems there's a missing subscript, nevertheless I draw it assuming complete octates.

Best regards.

explanation:

i think option no d is the correct answer